No products
View larger AOB37999
CAS: 1644342-14-2
Chemical Name: {(1R,2S,4R)-4-[(5-{[1-(3-Bromobenzyl)-1H-pyrazol-3-yl]carbonyl}pyrimidin-4-yl)amino]-2-hydroxycyclopentyl}methyl sulfamate
986 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $23.38 | Total: $116.88 |
| 1 | 10 | $19.80 | Total: $198.00 |
| 1 | 25 | $16.78 | Total: $419.38 |
| 1 | 50 | $14.30 | Total: $715.00 |
| 1 | 100 | $12.38 | Total: $1,237.50 |
| Molecular Formula | C21H23BrN6O5S |
| Molecular Weight | 551.42 |
| CAS Numbers | 1644342-14-2 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ML-792; ML 792; ML792 |
| IUPAC/Chemical Name | ((1R,2S,4R)-4-((5-(1-(3-bromobenzyl)-1H-pyrazole-3-carbonyl)pyrimidin-4-yl)amino)-2-hydroxycyclopentyl)methyl sulfamate |
| InChl Key | PZCKLTWSXFDLLP-OGWOLHLISA-N |
| InChl Code | InChI=1S/C21H23BrN6O5S/c22-15-3-1-2-13(6-15)10-28-5-4-18(27-28)20(30)17-9-24-12-25-21(17)26-16-7-14(19(29)8-16)11-33-34(23,31)32/h1-6,9,12,14,16,19,29H,7-8,10-11H2,(H2,23,31,32)(H,24,25,26)/t14-,16-,19+/m1/s1 |
| SMILES Code | O=S(OC[C@@H]1[C@@H](O)C[C@H](NC2=NC=NC=C2C(C3=NN(CC4=CC=CC(Br)=C4)C=C3)=O)C1)(N)=O |
| References | 1) He X, Riceberg J, Soucy T, Koenig E, Minissale J, Gallery M, Bernard H, Yang X, Liao H, Rabino C, Shah P, Xega K, Yan ZH, Sintchak M, Bradley J, Xu H, Duffey M, England D, Mizutani H, Hu Z, Guo J, Chau R, Dick LR, Brownell JE, Newcomb J, Langston S, Lightcap ES, Bence N, Pulukuri SM. Probing the roles of SUMOylation in cancer cell biology by using a selective SAE inhibitor. Nat Chem Biol. 2017 Nov;13(11):1164-1171. |
Novel potent mechanism-based SUMO-activating enzyme (SAE) inhibitor, selectively blocking SAE enzyme activity and total SUMOylation, thus decreasing cancer cell proliferation