No products
View larger AOB17400
CAS: 1044664-73-4
Chemical Name: 3-(5-((2-(6-((2,3-Dimethylphenyl)amino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl)hydrazineylidene)methyl)furan-2-yl)benzoic acid
95 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $109.65 | Total: $548.25 |
| 1 | 10 | $92.88 | Total: $928.80 |
| 1 | 25 | $78.69 | Total: $1,967.25 |
| 1 | 50 | $67.08 | Total: $3,354.00 |
| 1 | 100 | $58.05 | Total: $5,805.00 |
| Molecular Formula | C24H19N7O4 |
| Molecular Weight | 469.46 |
| CAS Numbers | 1044664-73-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | LQZ7F; LQZ 7F; LQZ-7F |
| IUPAC/Chemical Name | 3-(5-((2-(6-((2,3-Dimethylphenyl)amino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl)hydrazineylidene)methyl)furan-2-yl)benzoic acid |
| InChl Key | ONXLPQBYPUBYEJ-BRJLIKDPSA-N |
| InChl Code | InChI=1S/C24H19N7O4/c1-13-5-3-8-18(14(13)2)26-20-21(28-23-22(27-20)30-35-31-23)29-25-12-17-9-10-19(34-17)15-6-4-7-16(11-15)24(32)33/h3-12H,1-2H3,(H,32,33)(H,26,27,30)(H,28,29,31)/b25-12+ |
| SMILES Code | O=C(O)C1=CC=CC(C2=CC=C(/C=N/NC3=NC4=NON=C4N=C3NC5=CC=CC(C)=C5C)O2)=C1 |
Novel inhibitor of the dimerization of the oncoprotein survivin, being survivin degradation, mitotic arrest, and apoptosis, and blocking the growth of human tumors in mouse xenograft assays