No products
View larger AOB31451
CAS No: 1358488-78-4
Chemical Name: BRD-5529; 2-(4'-Carbamoyl-[1,4'-bipiperidin]-1'-yl)-5-(4-methylbenzamido)nicotinic acid
999 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 |
| CAS Numbers | 1358488-78-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | BRD5529; BRD 5529; BRD-5529 |
| IUPAC/Chemical Name | 2-(4'-Carbamoyl-[1,4'-bipiperidin]-1'-yl)-5-(4-methylbenzamido)nicotinic acid |
| InChl Key | ZXWHESBABUHJBE-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C25H31N5O4/c1-17-5-7-18(8-6-17)22(31)28-19-15-20(23(32)33)21(27-16-19)29-13-9-25(10-14-29,24(26)34)30-11-3-2-4-12-30/h5-8,15-16H,2-4,9-14H2,1H3,(H2,26,34)(H,28,31)(H,32,33) |
| SMILES Code | O=C(O)C1=C(N2CCC(N3CCCCC3)(C(N)=O)CC2)N=CC(NC(C4=CC=C(C)C=C4)=O)=C1 |
Novel selective inhibitor of CARD9, disrupting TRIM62 recruitment, inhibiting TRIM62-mediated ubiquitinylation of CARD9, and demonstrating cellular activity and selectivity in CARD9-dependent pathways