No products
View larger AOB5878
CAS No: 1190379-70-4
Chemical Name: Cyclobutanecarboxylic acid {3-[2-cyclopropyl-5-(2-methyl-1,2,3,4-tetrahydro-isoquinolin-6-ylamino)-phenylamino]-propyl}-amide
994 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.58 |
| CAS Numbers | 1190379-70-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MRT68921; MRT-68921; MRT 68921; MRT68921 free base |
| IUPAC/Chemical Name | Cyclobutanecarboxylic acid {3-[2-cyclopropyl-5-(2-methyl-1,2,3,4-tetrahydro-isoquinolin-6-ylamino)-phenylamino]-propyl}-amide |
| InChl Key | JGKCPXMSBDYENM-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C27H36N4O/c1-31-15-12-21-16-23(9-8-22(21)18-31)30-24-10-11-25(19-6-7-19)26(17-24)28-13-3-14-29-27(32)20-4-2-5-20/h8-11,16-17,19-20,28,30H,2-7,12-15,18H2,1H3,(H,29,32) |
| SMILES Code | O=C(C1CCC1)NCCCNC2=CC(NC3=CC4=C(CN(C)CC4)C=C3)=CC=C2C5CC5 |
| References | Petherick KJ, Conway OJ, Mpamhanga C, Osborne SA, Kamal A, Saxty B, Ganley IG. Pharmacological inhibition of ULK1 kinase blocks mammalian target of rapamycin (mTOR)-dependent autophagy. J Biol Chem. 2015 May 1;290(18):11376-83. |
Potent inhibitor of ULK1 and ULK2 in vitro, blocking autophagy in cells.