No products
View larger AOB33900
CAS No: 2216763-38-9
Chemical Name: 4-Bromo-6-((3,4-dichlorophenyl)thio)-1-(4-(dimethylcarbamoyl)benzyl)-1H-indole-2-carboxylic acid
130 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C25H19BrCl2N2O3S |
| Molecular Weight | 578.30 |
| CAS Numbers | 2216763-38-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 99% (HPLC) |
| Synonym | NR1; NR-1; NR 1 |
| IUPAC/Chemical Name | 4-Bromo-6-((3,4-dichlorophenyl)thio)-1-(4-(dimethylcarbamoyl)benzyl)-1H-indole-2-carboxylic acid |
| InChl Key | MJYFVDNMTKLGTH-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C25H19BrCl2N2O3S/c1-29(2)24(31)15-5-3-14(4-6-15)13-30-22-11-17(34-16-7-8-20(27)21(28)10-16)9-19(26)18(22)12-23(30)25(32)33/h3-12H,13H2,1-2H3,(H,32,33) |
| SMILES Code | O=C(C(N1CC2=CC=C(C(N(C)C)=O)C=C2)=CC3=C1C=C(SC4=CC=C(Cl)C(Cl)=C4)C=C3Br)O |
| References | Mahoney SJ, Narayan S, Molz L, Berstler LA, Kang SA, Vlasuk GP, Saiah E. A small molecule inhibitor of Rheb selectively targets mTORC1 signaling. Nat Commun. 2018 Feb 7;9(1):548. doi: 10.1038/s41467-018-03035-z. PubMed PMID: 29416044; PubMed Central PMCID: PMC5803267. |
Novel inhibitor of Rheb, selectively targeting mTORC1 signaling