No products
View larger AOB4100
CAS: 243984-11-4
Chemical Name: Resatorvid; CLI-095; TAK242; Ethyl (6R)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate
998 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C15H17NO4ClFS |
| Molecular Weight | 361.8 |
| CAS Numbers | 243984-11-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMF: 10 mg/ml DMSO: 10 mg/ml Ethanol: 20 mg/ml |
| Purity | 98% by HPLC |
| Synonym | Resatorvid; TAK242; TAK 242 |
| IUPAC/Chemical Name | 6R-[[(2-chloro-4-fluorophenyl)amino]sulfonyl]-1-cyclohexene-1-carboxylic acid, ethyl ester |
| InChl Key | LEEIJTHMHDMWLJ-CQSZACIVSA-N |
| InChl Code | InChI=1S/C15H17ClFNO4S/c1-2-22-15(19)11-5-3-4-6-14(11)23(20,21)18-13-8-7-10(17)9-12(13)16/h5,7-9,14,18H,2-4,6H2,1H3/t14-/m1/s1 |
| SMILES Code | FC1=CC(Cl)=C(NS([C@@H]2CCCC=C2C(OCC)=O)(=O)=O)C=C1 |
| References | 1) Huang, J., Zhou, Z., Zhou, M., et al. Development of benzoxazole deoxybenzoin oxime and acyloxylamine derivatives targeting innate immune sensors and xanthine oxidase for treatment of gout. Bioorg. Med. Chem. 26(8), 1653-1664 (2018). |
| PubChem ID | 4364841 |
Novel toll-like receptor 4 (TLR4) inhibitor