No products
View larger AOB17659
CAS: 2313525-90-3
Chemical Name: 2-Oxo-5-phenyl-N-(4-((5-(trifluoromethyl)pyridin-2-yl)oxy)phenethyl)pentanamide
957 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.47 |
| CAS Numbers | 2313525-90-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | LEI 110; LEI-110 |
| IUPAC/Chemical Name | 2-oxo-5-phenyl-N-(4-((5-(trifluoromethyl)pyridin-2-yl)oxy)phenethyl)pentanamide |
| InChl Key | DZHZISUSQMPBJQ-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C25H23F3N2O3/c26-25(27,28)20-11-14-23(30-17-20)33-21-12-9-19(10-13-21)15-16-29-24(32)22(31)8-4-7-18-5-2-1-3-6-18/h1-3,5-6,9-14,17H,4,7-8,15-16H2,(H,29,32) |
| SMILES Code | O=C(C(CCCC1=CC=CC=C1)=O)NCCC2=CC=C(C=C2)OC3=CC=C(C(F)(F)F)C=N3 |
| References | 1) Zhou, J., Mock, E.D., Martella, A., et al. Activity-based protein profiling identifies α-ketoamides as inhibitors for phospholipase A2 group XVI. ACS Chem. Biol. 14(2), 164-169 (2019). |
Novel potent PLA2G16 inhibitor (Ki = 20 nM), selectively pan-inhibiting the HRASLS family of thiol hydrolases (i.e., PLA2G16, HRASLS2, RARRES3 and iNAT), reducing cellular arachidonic acid levels and oleic acid-induced lipolysis in human HepG2 cells