No products
View larger AOB17938
CAS No: 355406-76-7
Chemical Name: N-(3-(Benzylamino)-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-N-(4-fluorobenzyl)acetamide
975 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C26H21FN2O3 |
| Molecular Weight | 428.46 |
| CAS Numbers | 355406-76-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | N-(3-(Benzylamino)-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-N-(4-fluorobenzyl)acetamide |
| InChl Key | COATXBHZYVUJQP-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C26H21FN2O3/c1-17(30)29(16-19-11-13-20(27)14-12-19)24-23(28-15-18-7-3-2-4-8-18)25(31)21-9-5-6-10-22(21)26(24)32/h2-14,28H,15-16H2,1H3 |
| SMILES Code | CC(N(C(C1=O)=C(NCC2=CC=CC=C2)C(C3=C1C=CC=C3)=O)CC4=CC=C(F)C=C4)=O |
| References | Lucki NC, Villa GR, Vergani N, Bollong MJ, Beyer BA, Lee JW, Anglin JL, Spangenberg SH, Chin EN, Sharma A, Johnson K, Sander PN, Gordon P, Skirboll SL, Wurdak H, Schultz PG, Mischel PS, Lairson LL. A cell type-selective apoptosis-inducing small molecule for the treatment of brain cancer. Proc Natl Acad Sci U S A. 2019 Mar 26;116(13):6435-6440 |
Novel cell type-selective apoptosis inducer in glioblastoma multiforme (GBM) cancer stem cells (CSCs)