No products
View larger AOB9587
CAS: 101714-41-4
Chemical Name: BiP inducer X; 2-(3,4-Dihydroxyphenyl)-2-oxoethyl thiocyanate
1395 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $9.35 | Total: $46.75 |
| 1 | 10 | $7.92 | Total: $79.20 |
| 1 | 25 | $6.71 | Total: $167.75 |
| 1 | 50 | $5.72 | Total: $286.00 |
| 1 | 100 | $4.95 | Total: $495.00 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.22 |
| CAS Numbers | 101714-41-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 2-(3,4-Dihydroxyphenyl)-2-oxoethyl ester thiocyanic acid |
| InChl Key | SVFLBLCWKKQKDW-UHFFFAOYSA-N |
| SMILES Code | O=C(CSC#N)C1=CC=C(O)C(O)=C1 |
| References | 1) Inokuchi Effect of an inducer of BiP, a molecular chaperone, on endoplasmic reticulum (ER) stress-induced retinal cell death. Invest.Ophthalmol.Vis.Sci. 2009 PMID: 18757512 2) Oida Induction of BiP, an ER-resident protein, prevents the neuronal death induced by transient forebrain ischemia in gerbil. Brain Res. 2008 PMID: 18395193 3) Kudo A molecular chaperone inducer protects neurons from ER stress. Cell Death Differ. 2008 PMID: 18049481 |
| PubChem ID | 16656807 |
BiP (HSP70-5) ER chaperone inducer