No products
View larger AOB87246
CAS: 1353550-13-6
Chemical Name: BI-1482694; HM61713
N-[3-[2-[4-(4-Methylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide
999 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $9.35 | Total: $46.75 |
| 1 | 10 | $7.92 | Total: $79.20 |
| 1 | 25 | $6.71 | Total: $167.75 |
| 1 | 50 | $5.72 | Total: $286.00 |
| 1 | 100 | $4.95 | Total: $495.00 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.59 |
| CAS Numbers | 1353550-13-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO and Alcohol |
| Purity | 98% by HPLC |
| Synonym | HM61713; HM 61713; HM-61713; BI 1482694; BI-1482694; BI1482694; Olmutinib. |
| IUPAC/Chemical Name | N-(3-((2-((4-(4-methylpiperazin-1-yl)phenyl)amino)thieno[3,2-d]pyrimidin-4-yl)oxy)phenyl)acrylamide |
| InChl Key | FDMQDKQUTRLUBU-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C26H26N6O2S/c1-3-23(33)27-19-5-4-6-21(17-19)34-25-24-22(11-16-35-24)29-26(30-25)28-18-7-9-20(10-8-18)32-14-12-31(2)13-15-32/h3-11,16-17H,1,12-15H2,2H3,(H,27,33)(H,28,29,30) |
| SMILES Code | C=CC(NC1=CC=CC(OC2=C3C(C=CS3)=NC(NC4=CC=C(N5CCN(C)CC5)C=C4)=N2)=C1)=O |
| References | 1) Liao, B.C., Lin, C.C., and Yang, J.C. Second and third-generation epidermal growth factor receptor tyrosine kinase inhibitors in advanced nonsmall cell lung cancer. Curr.Opin.Oncol. 27(2), 94-101 (2015).2) Stinchcombe, T.E. Targeted therapies for treatment of non-small cell lung cancer--recent advances and future perspectives. Int.J.Cancer 138(11), 2549-2561 (2016). |
Novel Bruton's tyrosine kinase inhibitor, suppressing B cell and monocyte activation and ameliorates arthritis in a mouse model