No products
View larger AOB12072
CAS: 1891087-61-8
Chemical Name: BAY1816032; 2-[3,5-Difluoro-4-[[3-[5-methoxy-4-[(3-methoxypyridin-4-yl)amino]pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]ethanol
999 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $41.65 | Total: $208.25 |
| 1 | 10 | $35.28 | Total: $352.80 |
| 1 | 25 | $29.89 | Total: $747.25 |
| 1 | 50 | $25.48 | Total: $1,274.00 |
| 1 | 100 | $22.05 | Total: $2,205.00 |
| Molecular Formula | C27H24F2N6O4 |
| Molecular Weight | 534.52 |
| CAS Numbers | 1891087-61-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | BAY-1816032; BAY 1816032; BAY1816032 |
| IUPAC/Chemical Name | 2-(3,5-difluoro-4-((3-(5-methoxy-4-((3-methoxypyridin-4-yl)amino)pyrimidin-2-yl)-1H-indazol-1-yl)methyl)phenoxy)ethan-1-ol |
| InChl Key | QVOGVAVHOLLLAZ-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C27H24F2N6O4/c1-37-23-13-30-8-7-21(23)32-26-24(38-2)14-31-27(33-26)25-17-5-3-4-6-22(17)35(34-25)15-18-19(28)11-16(12-20(18)29)39-10-9-36/h3-8,11-14,36H,9-10,15H2,1-2H3,(H,30,31,32,33) |
| SMILES Code | COC1=C(NC2=NC(C3=NN(CC4=C(F)C=C(OCCO)C=C4F)C5=C3C=CC=C5)=NC=C2OC)C=CN=C1 |
| References | 1) Siemeister G, Mengel A, Fernández-Montalván AE, et al. Inhibition of BUB1 Kinase by BAY 1816032 Sensitizes Tumor Cells toward Taxanes, ATR, and PARP Inhibitors In Vitro and In Vivo. Clin Cancer Res. 2019;25(4):1404–1414. doi:10.1158/1078-0432.CCR-18-0628 |
Novel potent and oral available BUB1 (budding uninhibited by benzimidazoles 1) kinase inhibitor