No products
View larger AOB14782
CAS: 1258292-64-6
Chemical Name: 2,6-Dichloro-N-[2-(cyclopropanecarbonylamino)pyridin-4-yl]benzamide
995 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $30.60 | Total: $153.00 |
| 1 | 10 | $25.92 | Total: $259.20 |
| 1 | 25 | $21.96 | Total: $549.00 |
| 1 | 50 | $18.72 | Total: $936.00 |
| 1 | 100 | $16.20 | Total: $1,620.00 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.2 |
| CAS Numbers | 1258292-64-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | GDC-046; GDC 046; GDC046 |
| IUPAC/Chemical Name | 2,6-dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide |
| InChl Key | IAFNAEGXTKTGHN-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C16H13Cl2N3O2/c17-11-2-1-3-12(18)14(11)16(23)20-10-6-7-19-13(8-10)21-15(22)9-4-5-9/h1-3,6-9H,4-5H2,(H2,19,20,21,22,23) |
| SMILES Code | O=C(NC1=CC(NC(C2CC2)=O)=NC=C1)C3=C(Cl)C=CC=C3Cl |
| References | 1) Liang J, van Abbema A, Balazs M, et al. Lead optimization of a 4-aminopyridine benzamide scaffold to identify potent, selective, and orally bioavailable TYK2 inhibitors. J Med Chem. 2013;56(11):4521-4536. doi:10.1021/jm400266t |
Novel dual inhibitor of Tyrosine-protein kinase TYK2 and pan-JAK