No products
View larger AOB1164
CAS No: 902523-58-4
Chemical Name: 2-Chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide; CID-9550710
497 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 |
| CAS Numbers | 902523-58-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | CID-9550710 |
| IUPAC/Chemical Name | 2-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-4-methyl-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| InChl Key | DGNXYXASQJMULD-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C20H23ClN2O3S/c1-4-25-16-7-6-13(10-17(16)26-5-2)8-9-22-20(24)15-11-18-14(23(15)3)12-19(21)27-18/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,22,24) |
| SMILES Code | CCOC1=C(OCC)C=C(CCNC(C2=CC(SC(Cl)=C3)=C3N2C)=O)C=C1 |
| References | 1) Zou, J., Ganji, S., Pass, I., et al. Potent inhibitors of lipid droplet formation. 1-17 (2011). |
Potent inhibitor of lipid droplet formation