No products
View larger AOB37765
CAS: 925069-34-7
Chemical Name: 2-(3-(4-Chlorobenzoyl)thioureido)-4-ethyl-5-methylthiophene-3-carboxamide
135 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $21.25 | Total: $106.25 |
| 1 | 10 | $18.00 | Total: $180.00 |
| 1 | 25 | $15.25 | Total: $381.25 |
| 1 | 50 | $13.00 | Total: $650.00 |
| 1 | 100 | $11.25 | Total: $1,125.00 |
| Molecular Formula | C16H16ClN3O2S2 |
| Molecular Weight | 381.89 |
| CAS Numbers | 925069-34-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | PI-273; PI273; PI 273 |
| IUPAC/Chemical Name | 2-(3-(4-chlorobenzoyl)thioureido)-4-ethyl-5-methylthiophene-3-carboxamide |
| InChl Key | MIERMBQDBLFAFW-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C16H16ClN3O2S2/c1-3-11-8(2)24-15(12(11)13(18)21)20-16(23)19-14(22)9-4-6-10(17)7-5-9/h4-7H,3H2,1-2H3,(H2,18,21)(H2,19,20,22,23) |
| SMILES Code | O=C(C1=C(NC(NC(C2=CC=C(Cl)C=C2)=O)=S)SC(C)=C1CC)N |
| References | 1) Li J, Gao Z, Zhao D, et al. PI-273, a Substrate-Competitive, Specific Small-Molecule Inhibitor of PI4KIIα, Inhibits the Growth of Breast Cancer Cells. Cancer Res. 2017;77(22):6253-6266. doi:10.1158/0008-5472.CAN-17-0484 |
Novel, potent, specific, substrate-competitive inhibitor of PI4KIIα