No products
View larger AOB5360
CAS No:1354235-96-3
Chemical Name: (1R,3S)-1-[3-[[4-(2-Fluorophenyl)pi
376 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $16.58 | Total: $82.88 |
| 1 | 10 | $14.04 | Total: $140.40 |
| 1 | 25 | $11.90 | Total: $297.38 |
| 1 | 50 | $10.14 | Total: $507.00 |
| 1 | 100 | $8.78 | Total: $877.50 |
| Molecular Formula | C30H31FN4O3 |
| Molecular Weight | 514.59 |
| CAS Numbers | 1354235-96-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Stock Solution Guide | 10 mMol/5.15 mg/1 mL of Solvent |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | (1R,3S)-1-[3-[[4-(2-fluorophenyl)-1-piperazinyl]methyl]-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChl Key | FUHCEERDBRGPQZ-LBNVMWSVSA-N |
| InChl Code | InChI=1S/C30H31FN4O3/c1-38-27-11-10-19(16-20(27)18-34-12-14-35(15-13-34)26-9-5-3-7-23(26)31)28-29-22(17-25(33-28)30(36)37)21-6-2-4-8-24(21)32-29/h2-11,16,25,28,32-33H,12-15,17-18H2,1H3,(H,36,37)/t25-,28+/m0/s1 |
| SMILES Code | FC1=CC=CC=C1N2CCN(CC3=CC([C@H]4N[C@H](C(O)=O)CC5=C4NC6=C5C=CC=C6)=CC=C3OC)CC2 |
| References | 1) Lam, A.K.M., and Galione, A. The endoplasmic reticulum and junctional membrane communication during calcium signaling. Biochimica et Biophysica Acta 1833(11), 2542-2559 (2013). 2) Naylor, E., Arredouani, A., Vasudevan, S.R., et al. Identification of a chemical probe for NAADP by virtual screening. Nature Chemical Biology 5(4), 220-226 (2009). |
A nicotinic acid adenine dinucleotide phosphate (NAADP) antagonist.