No products
View larger AOB33732
CAS No: 622795-76-0
Chemical Name: 4-[(1-Hydroxy-2-phenyl-1H-indol-3-yl)-pyridin-2-yl-methyl]-piperazine-1-carboxylic acid ethyl ester
516 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $49.30 | Total: $246.50 |
| 1 | 10 | $41.76 | Total: $417.60 |
| 1 | 25 | $35.38 | Total: $884.50 |
| 1 | 50 | $30.16 | Total: $1,508.00 |
| 1 | 100 | $26.10 | Total: $2,610.00 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 |
| CAS Numbers | 622795-76-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | PIP-199; PIP199; PIP 199 |
| IUPAC/Chemical Name | 4-[(1-Hydroxy-2-phenyl-1H-indol-3-yl)-pyridin-2-yl-methyl]-piperazine-1-carboxylic acid ethyl ester |
| InChl Key | ROTCTSYSZSYNHB-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C27H28N4O3/c1-2-34-27(32)30-18-16-29(17-19-30)26(22-13-8-9-15-28-22)24-21-12-6-7-14-23(21)31(33)25(24)20-10-4-3-5-11-20/h3-15,26,33H,2,16-19H2,1H3 |
| SMILES Code | O=C(N1CCN(C(C2=C(C3=CC=CC=C3)N(O)C4=C2C=CC=C4)C5=NC=CC=C5)CC1)OCC |
The most selective inhibitor of the RMI core complex/MM2 interaction