No products
View larger AOB0061
CAS No: 64-47-1
Chemical Name: (3aS)-cis-1,2,3,3a,8,8a-Hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-ol methylcarbamate hemisulfate
2899 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $24.65 | Total: $123.25 |
| 1 | 10 | $20.88 | Total: $208.80 |
| 1 | 25 | $17.69 | Total: $442.25 |
| 1 | 50 | $15.08 | Total: $754.00 |
| 1 | 100 | $13.05 | Total: $1,305.00 |
| Molecular Formula | C15H21N3O2.1/2H2SO4 |
| Molecular Weight | 324.39 |
| CAS Numbers | 64-47-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | Water 32 mg per mL |
| Purity | 98% by HPLC |
| Synonym | Eserine; Antilirium; Physostol; Esromiotin; Ezerin; |
| IUPAC/Chemical Name | (3aS)-cis-1,2,3,3a,8,8a-Hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-ol methylcarbamate hemisulfate |
| InChl Key | YYBNDIVPHIWTPK-UHFFFAOYSA-N |
| SMILES Code | OS(O)(=O)=O.CNC(=O)OC1=CC=C2N(C)C3N(C)CCC3(C)C2=C1.CNC(=O)OC1=CC=C2N(C)C3N(C)CCC3(C)C2=C1 |
| References | 1) Millard and Broomfield (1995) Anticholinesterases: medical applications of neurochemical principles. J.Neurochem 64 1909 PMID: 7722478 2) Merck Index 12 7540 |
| PubChem ID | 21872909 |
Acetylcholinesterase inhibitor, crosses the blood-brain barrier to forms a carbamylated enzyme complex with acetyl cholinesterase