No products
View larger AOB4615
CAS: 52869-18-8
Chemical Name: N-(9,10-Dioxo-9,10-dihydroanthracen-2-yl)benzamide
88 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $24.65 | Total: $123.25 |
| 1 | 10 | $20.88 | Total: $208.80 |
| 1 | 25 | $17.69 | Total: $442.25 |
| 1 | 50 | $15.08 | Total: $754.00 |
| 1 | 100 | $13.05 | Total: $1,305.00 |
| Molecular Formula | C21H13NO23 |
| Molecular Weight | 327.33 |
| CAS Numbers | 52869-18-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO and Alcohol |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | N-(9,10-Dioxo-9,10-dihydroanthracen-2-yl)benzamide |
| InChl Key | SIGATAYQAZTAOH-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C21H13NO3/c23-19-15-8-4-5-9-16(15)20(24)18-12-14(10-11-17(18)19)22-21(25)13-6-2-1-3-7-13/h1-12H,(H,22,25) |
| SMILES Code | C1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)C(=O)C4=CC=CC=C4C3=O |
Novel inhibitor of SARS-CoV replication, acting by preventing fusion of the viral membrane with the host cellular membrane