No products
View larger AOB13644
CAS: 1332175-56-0
Chemical Name: 6-[3-(4-Fluorobenzyl)-3-(hydroxymethyl)piperidin-1-yl]pyrazine-2-carboxamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $152.15 | Total: $760.75 |
| 1 | 10 | $128.88 | Total: $1,288.80 |
| 1 | 25 | $109.19 | Total: $2,729.75 |
| 1 | 50 | $93.08 | Total: $4,654.00 |
| 1 | 100 | $80.55 | Total: $8,055.00 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 |
| CAS Numbers | 1332175-56-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | rTRD01; rTRD-01; rTRD 01 |
| IUPAC/Chemical Name | 6-[3-(4-Fluorobenzyl)-3-(hydroxymethyl)piperidin-1-yl]pyrazine-2-carboxamide |
| InChl Key | MCTLSQYQBQKNRU-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C18H21FN4O2/c19-14-4-2-13(3-5-14)8-18(12-24)6-1-7-23(11-18)16-10-21-9-15(22-16)17(20)25/h2-5,9-10,24H,1,6-8,11-12H2,(H2,20,25) |
| SMILES Code | O=C(C1=NC(N2CC(CO)(CC3=CC=C(F)C=C3)CCC2)=CN=C1)N |
| References | 1) ACS Chem. Biol. 2019, 14, 9, 2006–2013 |
Novel TDP-43 ligand, binding to TDP-43's RRM1 and RRM2 domains, partially disrupting TDP-43's interaction with the hexanucleotide RNA repeat of the disease-linked c9orf72 gene, improving larval turning, an assay measuring neuromuscular coordination and strength