No products
View larger AOB6713
CAS No: 1770789-37-1
Chemical Name: N-[4-(1-Oxo-1,2,3,4-tetrahydro-pyrido[4,3-b]indol-5-yl)-butyl]-acetamide
987 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 |
| CAS Numbers | 1770789-37-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | N-[4-(1-Oxo-1,2,3,4-tetrahydro-pyrido[4,3-b]indol-5-yl)-butyl]-acetamide |
| InChl Key | RYVLOOXFFIFQEN-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H21N3O2/c1-12(21)18-9-4-5-11-20-14-7-3-2-6-13(14)16-15(20)8-10-19-17(16)22/h2-3,6-7H,4-5,8-11H2,1H3,(H,18,21)(H,19,22) |
| SMILES Code | CC(NCCCCN1C(CCN2)=C(C2=O)C3=C1C=CC=C3)=O |
| References | 1) Gacias M, et al. Chem Biol. 17:841(2014) 2) Zhao L, et al., J Neuroinflammation. 19;14(1):14 (2017) |
Selective inhibitor of the first bromodomain of BET proteins, accelerating the progression of mouse primary oligodendrocyte progenitors toward differentiation, whereas inhibition of both bromodomains of BET proteins hindered differentiation