No products
View larger AOB3575
CAS No: 58337-38-5
Chemical Name: erythro-9-(2-Hydroxy-3-nonyl)adenine hydrochloride
398 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $9.35 | Total: $46.75 |
| 1 | 10 | $7.92 | Total: $79.20 |
| 1 | 25 | $6.71 | Total: $167.75 |
| 1 | 50 | $5.72 | Total: $286.00 |
| 1 | 100 | $4.95 | Total: $495.00 |
| Molecular Formula | C14H23N5O • HCl |
| Molecular Weight | 313.8 |
| CAS Numbers | 58337-38-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMF: 30 mg/ml DMSO: 30 mg/ml DMSO:PBS(pH7.2) (1:1): 0.5 mg/ml Ethanol: 20 mg/ml Water: 10 mg/ml |
| Purity | 98% by HPLC |
| Synonym | NSC 263164; erythro-9-(2-Hydroxy-3-nonyl)adenine |
| IUPAC/Chemical Name | (αR,βS)-rel-6-amino-β-hexyl-α-methyl-9H-purine-9-ethanol, monohydrochloride |
| InChl Key | VVDXNJRUNJMYOZ-DHXVBOOMSA-N |
| InChl Code | InChI=1S/C14H23N5O.ClH/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19;/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17);1H/t10-,11+;/m1./s1 |
| SMILES Code | NC1=C2C(N([C@@H](CCCCCC)[C@H](O)C)C=N2)=NC=N1.Cl |
Selective inhibitor of cGMP-stimulated phosphodiesterase (PDE2) and potent inhibitor of adenosine deaminase