No products
View larger AOB11873
CAS: 1391385-57-1
Chemical Name: Cp8; (1-(3-Chlorophenethyl)-3-cyclopentylpyrimidine-2,4,6-(1H,3H,5H)-trione
983 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $45.05 | Total: $225.25 |
| 1 | 10 | $38.16 | Total: $381.60 |
| 1 | 25 | $32.33 | Total: $808.25 |
| 1 | 50 | $27.56 | Total: $1,378.00 |
| 1 | 100 | $23.85 | Total: $2,385.00 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.8 |
| CAS Numbers | 1391385-57-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | cp-PYT; cpPYT; cp PYT; Cp8; Cp-8; Cp 8 |
| IUPAC/Chemical Name | 1-(3-chlorophenethyl)-3-cyclopentylpyrimidine-2,4,6(1H,3H,5H)-trione |
| InChl Key | AJKSBVCOTKODMF-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H19ClN2O3/c18-13-5-3-4-12(10-13)8-9-19-15(21)11-16(22)20(17(19)23)14-6-1-2-7-14/h3-5,10,14H,1-2,6-9,11H2 |
| SMILES Code | ClC1=CC(CCN2C(CC(N(C3CCCC3)C2=O)=O)=O)=CC=C1 |
| References | 1) Garry Cooper et al., A Single Amino Acid Determines the Selectivity and Efficacy of Selective Negative Allosteric Modulators of CaV1.3 L-Type Calcium Channels, ACS Chem. Biol. 2020, 15, 9, 2539–2550 |
Novel Selective Negative Allosteric Modulator of CaV1.3 L-Type Calcium Channels