No products
View larger AOB37696
CAS No: 2446154-84-1
Chemical Name: 4-[3-(3-{[3-(2,6-Dichloro-phenyl)-5-methyl-isoxazol-4-ylmethyl]-amino}-benzoyl)-indol-1-yl]-butyric acid
618 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $29.75 | Total: $148.75 |
| 1 | 10 | $25.20 | Total: $252.00 |
| 1 | 25 | $21.35 | Total: $533.75 |
| 1 | 50 | $18.20 | Total: $910.00 |
| 1 | 100 | $15.75 | Total: $1,575.00 |
| Molecular Formula | C30H25Cl2N3O4 |
| Molecular Weight | 562.44 |
| CAS Numbers | 2446154-84-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | DS16570511; DS-16570511; DS 16570511 |
| IUPAC/Chemical Name | 4-[3-(3-{[3-(2,6-Dichloro-phenyl)-5-methyl-isoxazol-4-ylmethyl]-amino}-benzoyl)-indol-1-yl]-butyric acid |
| InChl Key | VIWYGRDFHWYDRW-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C30H25Cl2N3O4/c1-18-22(29(34-39-18)28-24(31)10-5-11-25(28)32)16-33-20-8-4-7-19(15-20)30(38)23-17-35(14-6-13-27(36)37)26-12-3-2-9-21(23)26/h2-5,7-12,15,17,33H,6,13-14,16H2,1H3,(H,36,37) |
| SMILES Code | O=C(O)CCCN1C=C(C(C2=CC=CC(NCC3=C(C)ON=C3C4=C(Cl)C=CC=C4Cl)=C2)=O)C5=C1C=CC=C5 |
| References | 1) Kon N, Murakoshi M, Isobe A, Kagechika K, Miyoshi N, Nagayama T. DS16570511 is a small-molecule inhibitor of the mitochondrial calcium uniporter. Cell DeathDiscov. 2017 Jul 17;3:17045. doi:10.1038/cddiscovery.2017.45. eCollection 2017.PubMed PMID: 28725491; PubMed Central PMCID: PMC5511861. |
Novel cell-permeable inhibitor of the mitochondrial calcium uniporter (MCU)