No products
View larger AOB17474
CAS No: 324579-65-9
Chemical Name: RNF5-IN-2; (E)-N-((Z)-4-benzyl-3-methyl-1,2,4-thiadiazol-5(4H)-ylidene)-N"-phenylbenzimidamide
982 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $47.60 | Total: $238.00 |
| 1 | 10 | $40.32 | Total: $403.20 |
| 1 | 25 | $34.16 | Total: $854.00 |
| 1 | 50 | $29.12 | Total: $1,456.00 |
| 1 | 100 | $25.20 | Total: $2,520.00 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 384.50 |
| CAS Numbers | 324579-65-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | RNF5 IN-2; RNF5-IN 2; RNF5-IN-2; RNF5 inhibitor Inh-2; RNF5 inhibitor Inh2 |
| IUPAC/Chemical Name | (E)-N-((Z)-4-benzyl-3-methyl-1,2,4-thiadiazol-5(4H)-ylidene)-N'-phenylbenzimidamide |
| InChl Key | FYZFQLYZABRFAZ-KUXGFVDGSA-N |
| InChl Code | InChI=1S/C23H20N4S/c1-18-26-28-23(27(18)17-19-11-5-2-6-12-19)25-22(20-13-7-3-8-14-20)24-21-15-9-4-10-16-21/h2-16H,17H2,1H3/b24-22+,25-23- |
| SMILES Code | CC1=NS/C(N1CC2=CC=CC=C2)=NC(C3=CC=CC=C3)=NC4=CC=CC=C4 |
Novel modulator of RNF5 downstream pathways, rescuing F508del-CFTR activity on human primary bronchial epithelia, decreasing ubiquitylation and increasing half-life of F508del-CFTR