No products
View larger AOB87341
CAS No:935888-69-0
Chemical Name: ONX-0912, PR-047
498 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C25H32N4O7S |
| Molecular Weight | 532.61 |
| CAS Numbers | 935888-69-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 99% (HPLC) |
| Synonym | ONX0912; ONX-0912; ONX 0912; PR047; PR-047; PR 047. |
| IUPAC/Chemical Name | N-((S)-3-methoxy-1-(((S)-3-methoxy-1-(((S)-1-((R)-2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl)amino)-1-oxopropan-2-yl)amino)-1-oxopropan-2-yl)-2-methylthiazole-5-carboxamide |
| InChl Key | SWZXEVABPLUDIO-WSZYKNRRSA-N |
| InChl Code | InChI=1S/C25H32N4O7S/c1-15-26-11-20(37-15)24(33)29-19(13-35-4)23(32)28-18(12-34-3)22(31)27-17(21(30)25(2)14-36-25)10-16-8-6-5-7-9-16/h5-9,11,17-19H,10,12-14H2,1-4H3,(H,27,31)(H,28,32)(H,29,33)/t17-,18-,19-,25+/m0/s1 |
| SMILES Code | O=C(C1=CN=C(C)S1)N[C@@H](COC)C(N[C@@H](COC)C(N[C@@H](CC2=CC=CC=C2)C([C@]3(C)OC3)=O)=O)=O |
| References | 1) Use of peptide epoxyketone proteasome inhibitors for metastasis suppression By Kirk, Christopher J.; Jiang, Jing From PCT Int. Appl. (2011), WO 2011060179 A1 20110519. 2) Combination of proteasome inhibitors and anti-hepatitis medication for treating hepatitis By Schubert, Ulrich From PCT Int. Appl. (2011), WO 2011009961 A1 20110127. |
An ORALLY ACTIVE and irreversible inhibitor of 20S proteasome inhibitor targeting primarily chymotrypsin-like activity