No products
View larger AOB17626
CAS: 714932-54-4
Chemical Name: 6-Methoxy-3-(5-phenyl-1,2,4-oxadiazol-3-yl)quinolin-2-ol
866 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 |
| CAS Numbers | 714932-54-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | NCGC00063279; NCGC000 63279; NCGC000-63279 |
| IUPAC/Chemical Name | 6-Methoxy-3-(5-phenyl-1,2,4-oxadiazol-3-yl)quinolin-2-ol |
| InChl Key | BRKAIFLXINCNLS-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C18H13N3O3/c1-23-13-7-8-15-12(9-13)10-14(17(22)19-15)16-20-18(24-21-16)11-5-3-2-4-6-11/h2-10H,1H3,(H,19,22) |
| SMILES Code | OC1=NC2=CC=C(OC)C=C2C=C1C3=NOC(C4=CC=CC=C4)=N3 |
| References | Joshua A Etc. A high-throughput screen to identify novel small molecule inhibitors of the Werner Syndrome Helicase-Nuclease (WRN), PLoS One. 2019; 14(1): e0210525. |
Novel inhibitor of the Werner Syndrome Helicase-Nuclease (WRN) helicase