No products
View larger AOB16677
CAS: 521972-99-6
Chemical Name: PS-1; NSC31192; (5Z)-5-[(Furan-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
1990 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $29.75 | Total: $148.75 |
| 1 | 10 | $25.20 | Total: $252.00 |
| 1 | 25 | $21.35 | Total: $533.75 |
| 1 | 50 | $18.20 | Total: $910.00 |
| 1 | 100 | $15.75 | Total: $1,575.00 |
| Molecular Formula | C8H5NO2S2 |
| Molecular Weight | 211.25 |
| CAS Numbers | 521972-99-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Protonstatin1; Protonstatin 1; NSC31192 |
| IUPAC/Chemical Name | (5Z)-5-[(Furan-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChl Key | ISSUVJNRFWFRIV-XQRVVYSFSA-N |
| InChl Code | InChI=1S/C8H5NO2S2/c10-7-6(13-8(12)9-7)4-5-2-1-3-11-5/h1-4H,(H,9,10,12)/b6-4- |
| SMILES Code | C1=COC(=C1)/C=C2/C(=O)NC(=S)S2 |
| References | 1) Yongging Yang et al., Testing the polar auxin transport model with a selective plasma membrane H+- ATPase inhibitor, JIPB 64(6):1229 (2022) |
Novel selective inhibitor of plasma membrane (PM) H+-ATPase activity, inhibiting auxin transport