No products
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $8.50 | Total: $42.50 |
| 1 | 10 | $7.20 | Total: $72.00 |
| 1 | 25 | $6.10 | Total: $152.50 |
| 1 | 50 | $5.20 | Total: $260.00 |
| 1 | 100 | $4.50 | Total: $450.00 |
| Molecular Formula | C22H23FN6O5 |
| Molecular Weight | 470.45 |
| CAS Numbers | 841290-80-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | R 406, R406, R-406, Tamatinib |
| IUPAC/Chemical Name | 6-[[5-fluoro-2-[(3,4,5-trimethoxyphenyl)amino]-4-pyrimidinyl]amino]-2,2-dimethyl-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one |
| InChl Key | NHHQJBCNYHBUSI-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C22H23FN6O5/c1-22(2)20(30)28-19-13(34-22)6-7-16(27-19)26-18-12(23)10-24-21(29-18)25-11-8-14(31-3)17(33-5)15(9-11)32-4/h6-10H,1-5H3,(H3,24,25,26,27,28,29,30) |
| SMILES Code | COC1=C(OC)C=C(NC2=NC(NC3=NC(NC(C(C)(C)O4)=O)=C4C=C3)=C(F)C=N2)C=C1OC |
| References | 1) Matsubara, S., Li, G., Takeda, K., et al. Inhibition of spleen tyrosine kinase prevents mast cell activation and airway hyperresponsiveness. American Journal of Respiration and Critical Care Medicine 173(1), 56-63 (2006). 2) Matsubara, S., Koya, T., Takeda, K., et al. Syk activation in dendritic cells is essential for airway hyperresponsiveness and inflammation. Am. J. Respir. Cell Mol. Biol. 34(4), 426-433 (2006). |