No products
View larger AOB11775
CAS: 1809170-59-9
Chemical Name: N-(3β-Hydroxy-Δ5-cholen-24-oyl)-L-tryptophan; ((R)-4-((3S,8S,9S,10R,13R,14S,17R)-3-Hydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl)-L-tryptophan
3951 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $41.65 | Total: $208.25 |
| 1 | 10 | $35.28 | Total: $352.80 |
| 1 | 25 | $29.89 | Total: $747.25 |
| 1 | 50 | $25.48 | Total: $1,274.00 |
| 1 | 100 | $22.05 | Total: $2,205.00 |
| Molecular Formula | C35H48N2O4 |
| Molecular Weight | 560.78 |
| CAS Numbers | 926657-43-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | UniPR1331; UniPR-1331; UniPR 1331 |
| IUPAC/Chemical Name | ((R)-4-((3S,8S,9S,10R,13R,14S,17R)-3-Hydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl)-L-tryptophan |
| InChl Key | KHFTUYLQBLIIEQ-ZSSZZUKFSA-N |
| InChl Code | InChI=1S/C35H48N2O4/c1-21(8-13-32(39)37-31(33(40)41)18-22-20-36-30-7-5-4-6-25(22)30)27-11-12-28-26-10-9-23-19-24(38)14-16-34(23,2)29(26)15-17-35(27,28)3/h4-7,9,20-21,24,26-29,31,36,38H,8,10-19H2,1-3H3,(H,37,39)(H,40,41)/t21-,24+,26+,27-,28+,29+,31+,34+,35-/m1/s1 |
| SMILES Code | O=C(O)[C@H](CC1=CNC2=C1C=CC=C2)NC(CC[C@H]([C@H]3CC[C@@]4([H])[C@]5([H])CC=C6C[C@@H](O)CC[C@]6(C)[C@@]5([H])CC[C@]34C)C)=O |
| References | 1) J Pharm Biomed Analysis 180:20 113067 (2020) |
Novel selective antagonist of the Eph-ephrin system