No products
View larger AOB14444
CAS: 2505339-87-5
Chemical Name: (S)-N-(2-(2-Cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-(4-cyanobenzyl)thiazole-4-carboxamide
2949 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C19H15F2N5O2S |
| Molecular Weight | 415.4188 |
| CAS Numbers | 505339-87-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | BR103354; BR 103354; BR-103354; |
| IUPAC/Chemical Name | (S)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-(4-cyanobenzyl)thiazole-4-carboxamide |
| InChl Key | PRKFSEKNKYVALC-AWEZNQCLSA-N |
| InChl Code | InChI=1S/C19H15F2N5O2S/c20-19(21)6-14(8-23)26(11-19)17(27)9-24-18(28)15-10-29-16(25-15)5-12-1-3-13(7-22)4-2-12/h1-4,10,14H,5-6,9,11H2,(H,24,28)/t14-/m0/s1 |
| SMILES Code | O=C(C1=CSC(CC2=CC=C(C#N)C=C2)=N1)NCC(N3[C@H](C#N)CC(F)(F)C3)=O |
| References | 1) Cho JM, Yang EH, Quan W, Nam EH, Cheon HG. Discovery of a novel fibroblast activation protein (FAP) inhibitor, BR103354, with anti-diabetic and anti- steatotic effects. Sci Rep. 2020 Dec 4;10(1):21280. doi: 10.1038/s41598-020-77978-z. PMID: 33277568; PMCID: PMC7718273. |
Novel fibroblast activation protein (FAP) inhibitor with anti-diabetic and anti-steatotic effects