No products
View larger AOB13238
CAS: 500285-30-3
Chemical Name: NSC26112; 1-Methyl-4-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene) methyl] benzene
482 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $82.45 | Total: $412.25 |
| 1 | 10 | $69.84 | Total: $698.40 |
| 1 | 25 | $59.17 | Total: $1,479.25 |
| 1 | 50 | $50.44 | Total: $2,522.00 |
| 1 | 100 | $43.65 | Total: $4,365.00 |
| Molecular Formula | C13H8Cl4 |
| Molecular Weight | 306.007 |
| CAS Numbers | 500285-30-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | CP26; CP-26; CP 26 |
| IUPAC/Chemical Name | 1-Methyl-4-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene) methyl] benzene |
| InChl Key | GLCNSQWOANYMNW-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C13H8Cl4/c1-7-2-4-8(5-3-7)6-9-10(14)12(16)13(17)11(9)15/h2-6H,1H3 |
| SMILES Code | ClC1=C(Cl)C(Cl)=C(Cl)/C1=C/C2=CC=C(C)C=C2 |
| References | 1) Ruan, J. et al., A small molecule inhibitor of ER-to-cytosol protein dislocation exhibits anti-dengue and anti-Zika virus activity, Sci Rep. 2019; 9: 10901. |
Novel inhibitor of ER-to-cytosol protein dislocation, exhibiting anti-dengue and anti-Zika virus activity