No products
View larger AOB11459
CAS: 2451862-42-1 (free base)
Chemical Name: GSK778 2HCl; 4-(2-(Methoxymethyl)-1-((R)-1-phenylethyl)-8-(((S)-pyrrolidin-3-yl)methoxy)-1H-imidazo[4,5-c]quinolin-7-yl)-3,5-dimethylisoxazole dihydrochloride
976 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $101.15 | Total: $505.75 |
| 1 | 10 | $85.68 | Total: $856.80 |
| 1 | 25 | $72.59 | Total: $1,814.75 |
| 1 | 50 | $61.88 | Total: $3,094.00 |
| 1 | 100 | $53.55 | Total: $5,355.00 |
| Molecular Formula | C30H35Cl2N5O3 |
| Molecular Weight | 584.5 |
| CAS Numbers | 2451862-42-1 (free base) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | GSK778 2HCl, iBETBD1 |
| IUPAC/Chemical Name | 4-(2-(Methoxymethyl)-1-((R)-1-phenylethyl)-8-(((S)-pyrrolidin-3-yl)methoxy)-1H-imidazo[4,5-c]quinolin-7-yl)-3,5-dimethylisoxazole dihydrochloride |
| SMILES Code | CC1=NOC(C)=C1C2=C(OC[C@@H]3CNCC3)C=C4C5=C(N=C(COC)N5[C@H](C)C6=CC=CC=C6)C=NC4=C2 |
| References | 1) Omer Gilan et al., Selective targeting of BD1 and BD2 of the BET proteins in cancer and immunoinflammation, Science 24 Apr 2020: |
Novel potent and selective BD1 inhibior (IC50: BRD2 BD1: 75nM; BRD3 BD1 41nM; BRD4 BD1 41nM)