No products
View larger AOB6083
CAS No:149647-78-9
Chemical Name:SAHA
4994 Items
| Quantity | 100 mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.00 | Total: $85.00 |
| 1 | 10 | $14.40 | Total: $144.00 |
| 1 | 25 | $12.20 | Total: $305.00 |
| 1 | 50 | $10.40 | Total: $520.00 |
| 1 | 100 | $9.00 | Total: $900.00 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 264.3 |
| CAS Numbers | 149647-78-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 99% (HPLC) |
| Synonym | N1-hydroxy-N8-phenyl-octanediamide |
| IUPAC/Chemical Name | SAHA; Suberoylanilide Hydroxamic Acid Vorinostat |
| InChl Key | WAEXFXRVDQXREF-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
| SMILES Code | ONC(=O)CCCCCCC(=O)Nc1ccccc1 |
| References | 1) Marks, P.A., and Breslow, R. Dimethyl sulfoxide to vorinostat: Development of this histone deacetylase inhibitor as an anticancer drug. Nat. Biotechnol. 25(1), 84-90 (2007). |
A small molecule inhibitor of histone deacetylase (HDAC)