No products
View larger AOB8254
CAS: 1263373-43-8
Chemical Name: NVP2; 4-[[[6-[5-Chloro-2-[[4-[[(2R)-1-methoxypropan-2-yl]amino]cyclohexyl]amino]pyridin-4-yl]pyridin-2-yl]amino]methyl]oxane-4-carbonitrile
988 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.88 | Total: $159.38 |
| 1 | 10 | $27.00 | Total: $270.00 |
| 1 | 25 | $22.88 | Total: $571.88 |
| 1 | 50 | $19.50 | Total: $975.00 |
| 1 | 100 | $16.88 | Total: $1,687.50 |
| Molecular Formula | C27H37ClN6O2 |
| Molecular Weight | 513.07 |
| CAS Numbers | 1263373-43-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO or EtOH 51.31 mg per 1 mL |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 4-[[[5'-Chloro-2'-[[trans-4-[[(1R)-2-methoxy-1-methylethyl]amino]cyclohexyl]amino][2,4'-bipyridin]-6-yl]amino]methyl]tetrahydro-2H-pyran-4-carbonitrile |
| InChl Key | XWQVQSXLXAXOPJ-QNGMFEMESA-N |
| SMILES Code | COC[C@H](N[C@H]1CC[C@H](NC2=CC(C3=NC(NCC4(C#N)CCOCC4)=CC=C3)=C(C=N2)Cl)CC1)C |
| References | 1) Olson et al (2018) Pharmacological perturbation of CDK9 using selective CDK9 inhibition or degradation. Nat.Chem.Biol. 14 163 PMID: 29251720 2) Winter et al (2017) BET bromodomain proteins function as master transcription elongation factors independent of CDK9 recruitment. Mol.Cell 67 5 PMID: 28673542 |
| PubChem ID | 66937006 |
Novel selective and ATP-competitive inhibitor of the cyclin-dependent kinase CDK9